C13H13N3O — CID 115036068
8-methoxy-9-methylpyrido[3,4-b]indol-1-amine (PubChem CID 115036068) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 8-methoxy-9-methylpyrido[3,4-b]indol-1-amine.
| Compound Name | 8-methoxy-9-methylpyrido[3,4-b]indol-1-amine |
|---|---|
| PubChem CID | 115036068 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 8-methoxy-9-methylpyrido[3,4-b]indol-1-amine |
| SMILES | COc1cccc2c3ccnc(N)c3n(C)c12 |
| InChI | InChI=1S/C13H13N3O/c1-16-11-8(4-3-5-10(11)17-2)9-6-7-15-13(14)12(9)16/h3-7H,1-2H3,(H2,14,15) |
| InChIKey | TZEZXCPAAAQXGG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |