C14H20N2O — CID 82495856
1-(7-methoxy-1,2-dimethylindol-3-yl)propan-2-amine (PubChem CID 82495856) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(7-methoxy-1,2-dimethylindol-3-yl)propan-2-amine.
| Compound Name | 1-(7-methoxy-1,2-dimethylindol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 82495856 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(7-methoxy-1,2-dimethylindol-3-yl)propan-2-amine |
| SMILES | COc1cccc2c(CC(C)N)c(C)n(C)c12 |
| InChI | InChI=1S/C14H20N2O/c1-9(15)8-12-10(2)16(3)14-11(12)6-5-7-13(14)17-4/h5-7,9H,8,15H2,1-4H3 |
| InChIKey | KHJVTFGNWIISMC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|