C18H23NO4 — CID 5319501
4,8-dimethoxy-3-(2-methoxy-3-methylbut-3-enyl)-1-methylquinolin-2-one (PubChem CID 5319501) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4,8-dimethoxy-3-(2-methoxy-3-methylbut-3-enyl)-1-methylquinolin-2-one.
| Compound Name | 4,8-dimethoxy-3-(2-methoxy-3-methylbut-3-enyl)-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 5319501 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4,8-dimethoxy-3-(2-methoxy-3-methylbut-3-enyl)-1-methylquinolin-2-one |
| SMILES | C=C(C)C(Cc1c(OC)c2cccc(OC)c2n(C)c1=O)OC |
| InChI | InChI=1S/C18H23NO4/c1-11(2)15(22-5)10-13-17(23-6)12-8-7-9-14(21-4)16(12)19(3)18(13)20/h7-9,15H,1,10H2,2-6H3 |
| InChIKey | UQPGYZLENAHHQZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|