C12H13N3O2 — CID 174611926
5-(2,3-dimethoxyphenyl)pyrimidin-4-amine (PubChem CID 174611926) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)pyrimidin-4-amine.
| Compound Name | 5-(2,3-dimethoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 174611926 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)pyrimidin-4-amine |
| SMILES | COc1cccc(-c2cncnc2N)c1OC |
| InChI | InChI=1S/C12H13N3O2/c1-16-10-5-3-4-8(11(10)17-2)9-6-14-7-15-12(9)13/h3-7H,1-2H3,(H2,13,14,15) |
| InChIKey | RXWSRXUGZSGWGO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |