C13H14N2O2 — CID 82794989
6-(2,3-dimethoxyphenyl)pyridin-3-amine (PubChem CID 82794989) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 6-(2,3-dimethoxyphenyl)pyridin-3-amine.
| Compound Name | 6-(2,3-dimethoxyphenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 82794989 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 6-(2,3-dimethoxyphenyl)pyridin-3-amine |
| SMILES | COc1cccc(-c2ccc(N)cn2)c1OC |
| InChI | InChI=1S/C13H14N2O2/c1-16-12-5-3-4-10(13(12)17-2)11-7-6-9(14)8-15-11/h3-8H,14H2,1-2H3 |
| InChIKey | QXZSFSXAIQHGDA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |