C12H13N3O3 — CID 79917584
4-(2,6-dimethoxyphenoxy)pyrimidin-5-amine (PubChem CID 79917584) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenoxy)pyrimidin-5-amine.
| Compound Name | 4-(2,6-dimethoxyphenoxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 79917584 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-(2,6-dimethoxyphenoxy)pyrimidin-5-amine |
| SMILES | COc1cccc(OC)c1Oc1ncncc1N |
| InChI | InChI=1S/C12H13N3O3/c1-16-9-4-3-5-10(17-2)11(9)18-12-8(13)6-14-7-15-12/h3-7H,13H2,1-2H3 |
| InChIKey | WFSMQEPVLSZZJC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |