C13H14N2O3 — CID 16783505
2-(2,6-dimethoxyphenoxy)pyridin-3-amine (PubChem CID 16783505) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)pyridin-3-amine.
| Compound Name | 2-(2,6-dimethoxyphenoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 16783505 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)pyridin-3-amine |
| SMILES | COc1cccc(OC)c1Oc1ncccc1N |
| InChI | InChI=1S/C13H14N2O3/c1-16-10-6-3-7-11(17-2)12(10)18-13-9(14)5-4-8-15-13/h3-8H,14H2,1-2H3 |
| InChIKey | JIXXMHATPJAGBC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |