C19H26N5O2+ — CID 71236416
3-(2,3-dimethoxyphenyl)-1,1-di(propan-2-yl)pyrazolo[3,4-d]pyrimidin-1-ium-4-amine (PubChem CID 71236416) has the molecular formula C19H26N5O2+ and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-1,1-di(propan-2-yl)pyrazolo[3,4-d]pyrimidin-1-ium-4-amine.
| Compound Name | 3-(2,3-dimethoxyphenyl)-1,1-di(propan-2-yl)pyrazolo[3,4-d]pyrimidin-1-ium-4-amine |
|---|---|
| PubChem CID | 71236416 |
| Molecular Formula | C19H26N5O2+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-1,1-di(propan-2-yl)pyrazolo[3,4-d]pyrimidin-1-ium-4-amine |
| SMILES | COc1cccc(C2=N[N+](C(C)C)(C(C)C)c3ncnc(N)c32)c1OC |
| InChI | InChI=1S/C19H26N5O2/c1-11(2)24(12(3)4)19-15(18(20)21-10-22-19)16(23-24)13-8-7-9-14(25-5)17(13)26-6/h7-12H,1-6H3,(H2,20,21,22)/q+1 |
| InChIKey | HBMSAEAPTTZDSA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|