C12H13NO2 — CID 115022882
1,8-dimethoxynaphthalen-2-amine (PubChem CID 115022882) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1,8-dimethoxynaphthalen-2-amine.
| Compound Name | 1,8-dimethoxynaphthalen-2-amine |
|---|---|
| PubChem CID | 115022882 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1,8-dimethoxynaphthalen-2-amine |
| SMILES | COc1cccc2ccc(N)c(OC)c12 |
| InChI | InChI=1S/C12H13NO2/c1-14-10-5-3-4-8-6-7-9(13)12(15-2)11(8)10/h3-7H,13H2,1-2H3 |
| InChIKey | YITOHLGKDRRDCL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|