C24H20N2O4 — CID 177471706
8,9-bis(4-methoxyphenyl)-[1,3]dioxolo[4,5-f]isoquinolin-6-amine (PubChem CID 177471706) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 8,9-bis(4-methoxyphenyl)-[1,3]dioxolo[4,5-f]isoquinolin-6-amine.
| Compound Name | 8,9-bis(4-methoxyphenyl)-[1,3]dioxolo[4,5-f]isoquinolin-6-amine |
|---|---|
| PubChem CID | 177471706 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 8,9-bis(4-methoxyphenyl)-[1,3]dioxolo[4,5-f]isoquinolin-6-amine |
| SMILES | COc1ccc(-c2nc(N)c3ccc4c(c3c2-c2ccc(OC)cc2)OCO4)cc1 |
| InChI | InChI=1S/C24H20N2O4/c1-27-16-7-3-14(4-8-16)20-21-18(11-12-19-23(21)30-13-29-19)24(25)26-22(20)15-5-9-17(28-2)10-6-15/h3-12H,13H2,1-2H3,(H2,25,26) |
| InChIKey | MYXHMMOSOIFZPC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |