C24H22N2O2 — CID 177422470
3,4-bis(4-methoxyphenyl)-7-methylisoquinolin-1-amine (PubChem CID 177422470) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenyl)-7-methylisoquinolin-1-amine.
| Compound Name | 3,4-bis(4-methoxyphenyl)-7-methylisoquinolin-1-amine |
|---|---|
| PubChem CID | 177422470 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3,4-bis(4-methoxyphenyl)-7-methylisoquinolin-1-amine |
| SMILES | COc1ccc(-c2nc(N)c3cc(C)ccc3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-15-4-13-20-21(14-15)24(25)26-23(17-7-11-19(28-3)12-8-17)22(20)16-5-9-18(27-2)10-6-16/h4-14H,1-3H3,(H2,25,26) |
| InChIKey | ANFPMWVCJHMFBX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |