C27H28N2 — CID 122214707
N-tert-butyl-3,4-bis(4-methylphenyl)isoquinolin-1-amine (PubChem CID 122214707) has the molecular formula C27H28N2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-tert-butyl-3,4-bis(4-methylphenyl)isoquinolin-1-amine.
| Compound Name | N-tert-butyl-3,4-bis(4-methylphenyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 122214707 |
| Molecular Formula | C27H28N2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-tert-butyl-3,4-bis(4-methylphenyl)isoquinolin-1-amine |
| SMILES | Cc1ccc(-c2nc(NC(C)(C)C)c3ccccc3c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H28N2/c1-18-10-14-20(15-11-18)24-22-8-6-7-9-23(22)26(29-27(3,4)5)28-25(24)21-16-12-19(2)13-17-21/h6-17H,1-5H3,(H,28,29) |
| InChIKey | ZHQHCDUOIMOVRG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |