C17H19N3O2 — CID 156773342
5-(tert-butylamino)-2,7-dimethylpyrrolo[3,4-c]isoquinoline-1,3-dione (PubChem CID 156773342) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 5-(tert-butylamino)-2,7-dimethylpyrrolo[3,4-c]isoquinoline-1,3-dione.
| Compound Name | 5-(tert-butylamino)-2,7-dimethylpyrrolo[3,4-c]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 156773342 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-(tert-butylamino)-2,7-dimethylpyrrolo[3,4-c]isoquinoline-1,3-dione |
| SMILES | Cc1ccc2c3c(nc(NC(C)(C)C)c2c1)C(=O)N(C)C3=O |
| InChI | InChI=1S/C17H19N3O2/c1-9-6-7-10-11(8-9)14(19-17(2,3)4)18-13-12(10)15(21)20(5)16(13)22/h6-8H,1-5H3,(H,18,19) |
| InChIKey | JGRYLGJUGVVJLT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|