C17H15NO — CID 153492990
3-phenyl-5,6,7,8-tetrahydrobenzo[f][1,2]benzoxazole (PubChem CID 153492990) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-phenyl-5,6,7,8-tetrahydrobenzo[f][1,2]benzoxazole.
| Compound Name | 3-phenyl-5,6,7,8-tetrahydrobenzo[f][1,2]benzoxazole |
|---|---|
| PubChem CID | 153492990 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-phenyl-5,6,7,8-tetrahydrobenzo[f][1,2]benzoxazole |
| SMILES | c1ccc(-c2noc3cc4c(cc23)CCCC4)cc1 |
| InChI | InChI=1S/C17H15NO/c1-2-6-12(7-3-1)17-15-10-13-8-4-5-9-14(13)11-16(15)19-18-17/h1-3,6-7,10-11H,4-5,8-9H2 |
| InChIKey | XEPBSRGJHUGDOM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |