C14H14N2 — CID 102496179
1-phenyl-5,6,7,8-tetrahydrophthalazine (PubChem CID 102496179) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-phenyl-5,6,7,8-tetrahydrophthalazine.
| Compound Name | 1-phenyl-5,6,7,8-tetrahydrophthalazine |
|---|---|
| PubChem CID | 102496179 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-phenyl-5,6,7,8-tetrahydrophthalazine |
| SMILES | c1ccc(-c2nncc3c2CCCC3)cc1 |
| InChI | InChI=1S/C14H14N2/c1-2-6-11(7-3-1)14-13-9-5-4-8-12(13)10-15-16-14/h1-3,6-7,10H,4-5,8-9H2 |
| InChIKey | QXDPFBCJIYHKEY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |