C28H18N4O — CID 153493031
3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-benzoxazole (PubChem CID 153493031) has the molecular formula C28H18N4O and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-benzoxazole.
| Compound Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 153493031 |
| Molecular Formula | C28H18N4O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4noc5ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C28H18N4O/c1-3-10-19(11-4-1)26-29-27(20-12-5-2-6-13-20)31-28(30-26)22-15-9-14-21(18-22)25-23-16-7-8-17-24(23)33-32-25/h1-18H |
| InChIKey | HHUXPXFNBYHJGQ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |