C55H37N5 — CID 151298818
2,4-diphenyl-6-[3-[3-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]phenyl]phenyl]-1,3,5-triazine (PubChem CID 151298818) has the molecular formula C55H37N5 and a molecular weight of 767.94 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-[3-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-[3-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 151298818 |
| Molecular Formula | C55H37N5 |
| Molecular Weight | 767.94 g/mol |
| Exact Mass | 767.30 |
| IUPAC Name | 2,4-diphenyl-6-[3-[3-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]phenyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)c(-c7ccccc7)nc6-c6ccccc6)c5)c4)c3)n2)cc1 |
| InChI | InChI=1S/C55H37N5/c1-6-19-38(20-7-1)49-50(39-21-8-2-9-22-39)57-52(51(56-49)40-23-10-3-11-24-40)47-33-17-31-45(36-47)43-29-16-30-44(35-43)46-32-18-34-48(37-46)55-59-53(41-25-12-4-13-26-41)58-54(60-55)42-27-14-5-15-28-42/h1-37H |
| InChIKey | OBZJIHAWTFPIAA-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.94 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |