C37H24ClN5 — CID 170781190
2-[3-(5-chloro-3,6-diphenylpyrazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 170781190) has the molecular formula C37H24ClN5 and a molecular weight of 574.09 g/mol. Its IUPAC name is 2-[3-(5-chloro-3,6-diphenylpyrazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(5-chloro-3,6-diphenylpyrazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170781190 |
| Molecular Formula | C37H24ClN5 |
| Molecular Weight | 574.09 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 2-[3-(5-chloro-3,6-diphenylpyrazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccccc2)c(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C37H24ClN5/c38-34-33(26-16-7-2-8-17-26)39-32(31(40-34)25-14-5-1-6-15-25)29-22-13-23-30(24-29)37-42-35(27-18-9-3-10-19-27)41-36(43-37)28-20-11-4-12-21-28/h1-24H |
| InChIKey | TWHKEDXMCPYNNH-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.09 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |