C49H33N5 — CID 156562939
2-phenyl-4-(3-phenylphenyl)-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine (PubChem CID 156562939) has the molecular formula C49H33N5 and a molecular weight of 691.84 g/mol. Its IUPAC name is 2-phenyl-4-(3-phenylphenyl)-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(3-phenylphenyl)-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 156562939 |
| Molecular Formula | C49H33N5 |
| Molecular Weight | 691.84 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | 2-phenyl-4-(3-phenylphenyl)-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5nc(-c6ccccc6)c(-c6ccccc6)nc5-c5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C49H33N5/c1-6-18-34(19-7-1)39-28-16-30-41(32-39)48-52-47(38-26-14-5-15-27-38)53-49(54-48)42-31-17-29-40(33-42)46-45(37-24-12-4-13-25-37)50-43(35-20-8-2-9-21-35)44(51-46)36-22-10-3-11-23-36/h1-33H |
| InChIKey | OILHKQCWPINUKJ-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.84 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |