C10H9NO4 — CID 84674857
3-(7-hydroxy-1,2-benzoxazol-3-yl)propanoic acid (PubChem CID 84674857) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-(7-hydroxy-1,2-benzoxazol-3-yl)propanoic acid.
| Compound Name | 3-(7-hydroxy-1,2-benzoxazol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 84674857 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-(7-hydroxy-1,2-benzoxazol-3-yl)propanoic acid |
| SMILES | O=C(O)CCc1noc2c(O)cccc12 |
| InChI | InChI=1S/C10H9NO4/c12-8-3-1-2-6-7(4-5-9(13)14)11-15-10(6)8/h1-3,12H,4-5H2,(H,13,14) |
| InChIKey | MDAPOILZSRPACB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |