3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid

C11H11NO4 — CID 105477082

IUPAC3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid
SMILESCOc1cccc2c(CCC(=O)O)onc12
InChIInChI=1S/C11H11NO4/c1-15-9-4-2-3-7-8(5-6-10(13)14)16-12-11(7)9/h2-4H,5-6H2,1H3,(H,13,14)
InChIKeyBWLRAQCARNHETM-UHFFFAOYSA-N
MW221.21 g/mol
LogP1.85
Rot. Bonds4

About 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid

3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid (PubChem CID 105477082) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid
PubChem CID105477082
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid
SMILESCOc1cccc2c(CCC(=O)O)onc12
InChIInChI=1S/C11H11NO4/c1-15-9-4-2-3-7-8(5-6-10(13)14)16-12-11(7)9/h2-4H,5-6H2,1H3,(H,13,14)
InChIKeyBWLRAQCARNHETM-UHFFFAOYSA-N
XLogP1.85
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 51.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid?
The IUPAC name of 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid (CID 105477082) is 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid.
What is the SMILES notation for 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid?
The canonical SMILES for 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid is COc1cccc2c(CCC(=O)O)onc12.
What is the InChIKey of 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid?
The InChIKey is BWLRAQCARNHETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-15-9-4-2-3-7-8(5-6-10(13)14)16-12-11(7)9/h2-4H,5-6H2,1H3,(H,13,14).
What are the key properties of 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid?
3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid has a molecular weight of 221.21 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methoxy-2,1-benzoxazol-3-yl)propanoic acid is sourced from PubChem (CID 105477082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).