C11H14N2O2 — CID 105458924
2-(7-methoxy-2,1-benzoxazol-3-yl)-N-methylethanamine (PubChem CID 105458924) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(7-methoxy-2,1-benzoxazol-3-yl)-N-methylethanamine.
| Compound Name | 2-(7-methoxy-2,1-benzoxazol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105458924 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(7-methoxy-2,1-benzoxazol-3-yl)-N-methylethanamine |
| SMILES | CNCCc1onc2c(OC)cccc12 |
| InChI | InChI=1S/C11H14N2O2/c1-12-7-6-9-8-4-3-5-10(14-2)11(8)13-15-9/h3-5,12H,6-7H2,1-2H3 |
| InChIKey | PJDKKLPKWCKFAI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |