C9H7NO5 — CID 84676549
2-[(7-hydroxy-1,2-benzoxazol-3-yl)oxy]acetic acid (PubChem CID 84676549) has the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-[(7-hydroxy-1,2-benzoxazol-3-yl)oxy]acetic acid.
| Compound Name | 2-[(7-hydroxy-1,2-benzoxazol-3-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 84676549 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-[(7-hydroxy-1,2-benzoxazol-3-yl)oxy]acetic acid |
| SMILES | O=C(O)COc1noc2c(O)cccc12 |
| InChI | InChI=1S/C9H7NO5/c11-6-3-1-2-5-8(6)15-10-9(5)14-4-7(12)13/h1-3,11H,4H2,(H,12,13) |
| InChIKey | JIMBLDBZCMNYEW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |