C13H14O4S — CID 18351575
2-[[3-(2-methylsulfanylethyl)-1-benzofuran-7-yl]oxy]acetic acid (PubChem CID 18351575) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[[3-(2-methylsulfanylethyl)-1-benzofuran-7-yl]oxy]acetic acid.
| Compound Name | 2-[[3-(2-methylsulfanylethyl)-1-benzofuran-7-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 18351575 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[[3-(2-methylsulfanylethyl)-1-benzofuran-7-yl]oxy]acetic acid |
| SMILES | CSCCc1coc2c(OCC(=O)O)cccc12 |
| InChI | InChI=1S/C13H14O4S/c1-18-6-5-9-7-17-13-10(9)3-2-4-11(13)16-8-12(14)15/h2-4,7H,5-6,8H2,1H3,(H,14,15) |
| InChIKey | PFDZESBPGYRALQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |