C28H28O4S — CID 11271140
methyl 2-[[3-[3-(2,2-diphenylethylsulfanyl)propyl]-1-benzofuran-7-yl]oxy]acetate (PubChem CID 11271140) has the molecular formula C28H28O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is methyl 2-[[3-[3-(2,2-diphenylethylsulfanyl)propyl]-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | methyl 2-[[3-[3-(2,2-diphenylethylsulfanyl)propyl]-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 11271140 |
| Molecular Formula | C28H28O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | methyl 2-[[3-[3-(2,2-diphenylethylsulfanyl)propyl]-1-benzofuran-7-yl]oxy]acetate |
| SMILES | COC(=O)COc1cccc2c(CCCSCC(c3ccccc3)c3ccccc3)coc12 |
| InChI | InChI=1S/C28H28O4S/c1-30-27(29)19-31-26-16-8-15-24-23(18-32-28(24)26)14-9-17-33-20-25(21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-8,10-13,15-16,18,25H,9,14,17,19-20H2,1H3 |
| InChIKey | VEUHQFRVMWRMRU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|