C31H31ClO5S — CID 15453039
methyl 2-[5-[2-[3-[(4-chlorophenyl)-phenylmethoxy]-2-hydroxypropyl]sulfanylethyl]naphthalen-1-yl]oxyacetate (PubChem CID 15453039) has the molecular formula C31H31ClO5S and a molecular weight of 551.10 g/mol. Its IUPAC name is methyl 2-[5-[2-[3-[(4-chlorophenyl)-phenylmethoxy]-2-hydroxypropyl]sulfanylethyl]naphthalen-1-yl]oxyacetate.
| Compound Name | methyl 2-[5-[2-[3-[(4-chlorophenyl)-phenylmethoxy]-2-hydroxypropyl]sulfanylethyl]naphthalen-1-yl]oxyacetate |
|---|---|
| PubChem CID | 15453039 |
| Molecular Formula | C31H31ClO5S |
| Molecular Weight | 551.10 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | methyl 2-[5-[2-[3-[(4-chlorophenyl)-phenylmethoxy]-2-hydroxypropyl]sulfanylethyl]naphthalen-1-yl]oxyacetate |
| SMILES | COC(=O)COc1cccc2c(CCSCC(O)COC(c3ccccc3)c3ccc(Cl)cc3)cccc12 |
| InChI | InChI=1S/C31H31ClO5S/c1-35-30(34)20-36-29-12-6-10-27-22(9-5-11-28(27)29)17-18-38-21-26(33)19-37-31(23-7-3-2-4-8-23)24-13-15-25(32)16-14-24/h2-16,26,31,33H,17-21H2,1H3 |
| InChIKey | IFEPXIUAENQTDP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.10 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|