C27H26O4S — CID 11190054
methyl 2-[[3-(3-benzhydrylsulfanylpropyl)-1-benzofuran-7-yl]oxy]acetate (PubChem CID 11190054) has the molecular formula C27H26O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is methyl 2-[[3-(3-benzhydrylsulfanylpropyl)-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | methyl 2-[[3-(3-benzhydrylsulfanylpropyl)-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 11190054 |
| Molecular Formula | C27H26O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 2-[[3-(3-benzhydrylsulfanylpropyl)-1-benzofuran-7-yl]oxy]acetate |
| SMILES | COC(=O)COc1cccc2c(CCCSC(c3ccccc3)c3ccccc3)coc12 |
| InChI | InChI=1S/C27H26O4S/c1-29-25(28)19-30-24-16-8-15-23-22(18-31-26(23)24)14-9-17-32-27(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-8,10-13,15-16,18,27H,9,14,17,19H2,1H3 |
| InChIKey | QZGLBTLHPDUASH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|