C22H24O5 — CID 54559021
methyl 2-[[3-[[(2R)-2-phenylbutoxy]methyl]-1-benzofuran-7-yl]oxy]acetate (PubChem CID 54559021) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl 2-[[3-[[(2R)-2-phenylbutoxy]methyl]-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | methyl 2-[[3-[[(2R)-2-phenylbutoxy]methyl]-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 54559021 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl 2-[[3-[[(2R)-2-phenylbutoxy]methyl]-1-benzofuran-7-yl]oxy]acetate |
| SMILES | CC[C@@H](COCc1coc2c(OCC(=O)OC)cccc12)c1ccccc1 |
| InChI | InChI=1S/C22H24O5/c1-3-16(17-8-5-4-6-9-17)12-25-13-18-14-27-22-19(18)10-7-11-20(22)26-15-21(23)24-2/h4-11,14,16H,3,12-13,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | ZPFCVCCHDYSPOD-INIZCTEOSA-N |
| XLogP | 4.70 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |