C17H15NO6S — CID 15908539
2-[[3-(benzenesulfonamidomethyl)-1-benzofuran-7-yl]oxy]acetic acid (PubChem CID 15908539) has the molecular formula C17H15NO6S and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-[[3-(benzenesulfonamidomethyl)-1-benzofuran-7-yl]oxy]acetic acid.
| Compound Name | 2-[[3-(benzenesulfonamidomethyl)-1-benzofuran-7-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 15908539 |
| Molecular Formula | C17H15NO6S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-[[3-(benzenesulfonamidomethyl)-1-benzofuran-7-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c(CNS(=O)(=O)c3ccccc3)coc12 |
| InChI | InChI=1S/C17H15NO6S/c19-16(20)11-23-15-8-4-7-14-12(10-24-17(14)15)9-18-25(21,22)13-5-2-1-3-6-13/h1-8,10,18H,9,11H2,(H,19,20) |
| InChIKey | VOAHUCCCNIKHHK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |