C22H25NO6S — CID 15908540
2-[[3-[(5-phenylpentylsulfonylamino)methyl]-1-benzofuran-7-yl]oxy]acetic acid (PubChem CID 15908540) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-[[3-[(5-phenylpentylsulfonylamino)methyl]-1-benzofuran-7-yl]oxy]acetic acid.
| Compound Name | 2-[[3-[(5-phenylpentylsulfonylamino)methyl]-1-benzofuran-7-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 15908540 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[[3-[(5-phenylpentylsulfonylamino)methyl]-1-benzofuran-7-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c(CNS(=O)(=O)CCCCCc3ccccc3)coc12 |
| InChI | InChI=1S/C22H25NO6S/c24-21(25)16-28-20-12-7-11-19-18(15-29-22(19)20)14-23-30(26,27)13-6-2-5-10-17-8-3-1-4-9-17/h1,3-4,7-9,11-12,15,23H,2,5-6,10,13-14,16H2,(H,24,25) |
| InChIKey | ARLGILYBOXMJCY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|