C19H16NO6- — CID 18351719
2-[[3-[[(2-phenoxyacetyl)amino]methyl]-1-benzofuran-7-yl]oxy]acetate (PubChem CID 18351719) has the molecular formula C19H16NO6- and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-[[3-[[(2-phenoxyacetyl)amino]methyl]-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | 2-[[3-[[(2-phenoxyacetyl)amino]methyl]-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 18351719 |
| Molecular Formula | C19H16NO6- |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[[3-[[(2-phenoxyacetyl)amino]methyl]-1-benzofuran-7-yl]oxy]acetate |
| SMILES | O=C([O-])COc1cccc2c(CNC(=O)COc3ccccc3)coc12 |
| InChI | InChI=1S/C19H17NO6/c21-17(11-24-14-5-2-1-3-6-14)20-9-13-10-26-19-15(13)7-4-8-16(19)25-12-18(22)23/h1-8,10H,9,11-12H2,(H,20,21)(H,22,23)/p-1 |
| InChIKey | PDVGDXSDPAJZEL-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |