C20H14NO5- — CID 18351770
2-[[3-[(4-phenyl-1,3-oxazol-2-yl)methyl]-1-benzofuran-7-yl]oxy]acetate (PubChem CID 18351770) has the molecular formula C20H14NO5- and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-[[3-[(4-phenyl-1,3-oxazol-2-yl)methyl]-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | 2-[[3-[(4-phenyl-1,3-oxazol-2-yl)methyl]-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 18351770 |
| Molecular Formula | C20H14NO5- |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[[3-[(4-phenyl-1,3-oxazol-2-yl)methyl]-1-benzofuran-7-yl]oxy]acetate |
| SMILES | O=C([O-])COc1cccc2c(Cc3nc(-c4ccccc4)co3)coc12 |
| InChI | InChI=1S/C20H15NO5/c22-19(23)12-24-17-8-4-7-15-14(10-26-20(15)17)9-18-21-16(11-25-18)13-5-2-1-3-6-13/h1-8,10-11H,9,12H2,(H,22,23)/p-1 |
| InChIKey | LZOJEBHFECFTSN-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 88.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |