C27H25O5- — CID 18351568
2-[[3-[2-(3,3-diphenylpropoxy)ethyl]-1-benzofuran-7-yl]oxy]acetate (PubChem CID 18351568) has the molecular formula C27H25O5- and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-[[3-[2-(3,3-diphenylpropoxy)ethyl]-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | 2-[[3-[2-(3,3-diphenylpropoxy)ethyl]-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 18351568 |
| Molecular Formula | C27H25O5- |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[[3-[2-(3,3-diphenylpropoxy)ethyl]-1-benzofuran-7-yl]oxy]acetate |
| SMILES | O=C([O-])COc1cccc2c(CCOCCC(c3ccccc3)c3ccccc3)coc12 |
| InChI | InChI=1S/C27H26O5/c28-26(29)19-31-25-13-7-12-24-22(18-32-27(24)25)14-16-30-17-15-23(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,23H,14-17,19H2,(H,28,29)/p-1 |
| InChIKey | AMJKNQKYVKXOBA-UHFFFAOYSA-M |
| XLogP | 4.34 |
| TPSA | 71.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|