C26H23O4S- — CID 18351565
2-[[3-(2-benzhydrylsulfanylethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate (PubChem CID 18351565) has the molecular formula C26H23O4S- and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[[3-(2-benzhydrylsulfanylethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | 2-[[3-(2-benzhydrylsulfanylethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 18351565 |
| Molecular Formula | C26H23O4S- |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[[3-(2-benzhydrylsulfanylethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate |
| SMILES | Cc1oc2c(OCC(=O)[O-])cccc2c1CCSC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24O4S/c1-18-21(22-13-8-14-23(25(22)30-18)29-17-24(27)28)15-16-31-26(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-14,26H,15-17H2,1H3,(H,27,28)/p-1 |
| InChIKey | ICACWRAIKRPDLX-UHFFFAOYSA-M |
| XLogP | 4.94 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |