C13H14AcNO4- — CID 20708391
actinium;[7-(2-methoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-yl]methylazanide (PubChem CID 20708391) has the molecular formula C13H14AcNO4- and a molecular weight of 475.26 g/mol. Its IUPAC name is actinium;[7-(2-methoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-yl]methylazanide.
| Compound Name | actinium;[7-(2-methoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-yl]methylazanide |
|---|---|
| PubChem CID | 20708391 |
| Molecular Formula | C13H14AcNO4- |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | actinium;[7-(2-methoxy-2-oxoethoxy)-2-methyl-1-benzofuran-3-yl]methylazanide |
| SMILES | COC(=O)COc1cccc2c(C[NH-])c(C)oc12.[Ac] |
| InChI | InChI=1S/C13H14NO4.Ac/c1-8-10(6-14)9-4-3-5-11(13(9)18-8)17-7-12(15)16-2;/h3-5,14H,6-7H2,1-2H3;/q-1; |
| InChIKey | FEIRVNGERNVKIY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |