C15H18AcNO4- — CID 20708348
actinium;[7-(2-methoxy-2-oxoethoxy)-2-propan-2-yl-1-benzofuran-3-yl]methylazanide (PubChem CID 20708348) has the molecular formula C15H18AcNO4- and a molecular weight of 503.31 g/mol. Its IUPAC name is actinium;[7-(2-methoxy-2-oxoethoxy)-2-propan-2-yl-1-benzofuran-3-yl]methylazanide.
| Compound Name | actinium;[7-(2-methoxy-2-oxoethoxy)-2-propan-2-yl-1-benzofuran-3-yl]methylazanide |
|---|---|
| PubChem CID | 20708348 |
| Molecular Formula | C15H18AcNO4- |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | actinium;[7-(2-methoxy-2-oxoethoxy)-2-propan-2-yl-1-benzofuran-3-yl]methylazanide |
| SMILES | COC(=O)COc1cccc2c(C[NH-])c(C(C)C)oc12.[Ac] |
| InChI | InChI=1S/C15H18NO4.Ac/c1-9(2)14-11(7-16)10-5-4-6-12(15(10)20-14)19-8-13(17)18-3;/h4-6,9,16H,7-8H2,1-3H3;/q-1; |
| InChIKey | TUYOHLFDAGIUGU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |