C25H27N3O7 — CID 91305588
3-(2-hydroxyethyl)-2-methyl-1-benzofuran-7-ol;methyl 2-[[3-(2-azidoethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate (PubChem CID 91305588) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2-methyl-1-benzofuran-7-ol;methyl 2-[[3-(2-azidoethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | 3-(2-hydroxyethyl)-2-methyl-1-benzofuran-7-ol;methyl 2-[[3-(2-azidoethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 91305588 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-(2-hydroxyethyl)-2-methyl-1-benzofuran-7-ol;methyl 2-[[3-(2-azidoethyl)-2-methyl-1-benzofuran-7-yl]oxy]acetate |
| SMILES | COC(=O)COc1cccc2c(CCN=[N+]=[N-])c(C)oc12.Cc1oc2c(O)cccc2c1CCO |
| InChI | InChI=1S/C14H15N3O4.C11H12O3/c1-9-10(6-7-16-17-15)11-4-3-5-12(14(11)21-9)20-8-13(18)19-2;1-7-8(5-6-12)9-3-2-4-10(13)11(9)14-7/h3-5H,6-8H2,1-2H3;2-4,12-13H,5-6H2,1H3 |
| InChIKey | CLJMABRFEUOWSR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|