C12H13O4P — CID 20708429
methyl 2-(2-methyl-7-phosphanyloxy-1-benzofuran-3-yl)acetate (PubChem CID 20708429) has the molecular formula C12H13O4P and a molecular weight of 252.21 g/mol. Its IUPAC name is methyl 2-(2-methyl-7-phosphanyloxy-1-benzofuran-3-yl)acetate.
| Compound Name | methyl 2-(2-methyl-7-phosphanyloxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 20708429 |
| Molecular Formula | C12H13O4P |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | methyl 2-(2-methyl-7-phosphanyloxy-1-benzofuran-3-yl)acetate |
| SMILES | COC(=O)Cc1c(C)oc2c(OP)cccc12 |
| InChI | InChI=1S/C12H13O4P/c1-7-9(6-11(13)14-2)8-4-3-5-10(16-17)12(8)15-7/h3-5H,6,17H2,1-2H3 |
| InChIKey | WYFUHFMPKZGNIH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|