C15H15O5- — CID 18351638
2-[[3-(2-hydroxyethyl)-2-prop-2-enyl-1-benzofuran-7-yl]oxy]acetate (PubChem CID 18351638) has the molecular formula C15H15O5- and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[[3-(2-hydroxyethyl)-2-prop-2-enyl-1-benzofuran-7-yl]oxy]acetate.
| Compound Name | 2-[[3-(2-hydroxyethyl)-2-prop-2-enyl-1-benzofuran-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 18351638 |
| Molecular Formula | C15H15O5- |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[[3-(2-hydroxyethyl)-2-prop-2-enyl-1-benzofuran-7-yl]oxy]acetate |
| SMILES | C=CCc1oc2c(OCC(=O)[O-])cccc2c1CCO |
| InChI | InChI=1S/C15H16O5/c1-2-4-12-10(7-8-16)11-5-3-6-13(15(11)20-12)19-9-14(17)18/h2-3,5-6,16H,1,4,7-9H2,(H,17,18)/p-1 |
| InChIKey | DHWRGYWMNKOYTD-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|