C13H14O4 — CID 22734085
ethyl 2-(7-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 22734085) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is ethyl 2-(7-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | ethyl 2-(7-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 22734085 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | ethyl 2-(7-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | CCOC(=O)Cc1coc2c(OC)cccc12 |
| InChI | InChI=1S/C13H14O4/c1-3-16-12(14)7-9-8-17-13-10(9)5-4-6-11(13)15-2/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | AQAPLCQZEQKKEX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |