C19H18O4 — CID 8778381
(2-methoxyphenyl) 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate (PubChem CID 8778381) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2-methoxyphenyl) 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate.
| Compound Name | (2-methoxyphenyl) 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8778381 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (2-methoxyphenyl) 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccccc1OC(=O)Cc1coc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C19H18O4/c1-12-8-9-15-14(11-22-19(15)13(12)2)10-18(20)23-17-7-5-4-6-16(17)21-3/h4-9,11H,10H2,1-3H3 |
| InChIKey | BZYTWNCFTOPIGO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|