C15H18O3 — CID 146470701
1-(7-methoxy-1-benzofuran-3-yl)-3,3-dimethylbutan-2-one (PubChem CID 146470701) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(7-methoxy-1-benzofuran-3-yl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(7-methoxy-1-benzofuran-3-yl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 146470701 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-(7-methoxy-1-benzofuran-3-yl)-3,3-dimethylbutan-2-one |
| SMILES | COc1cccc2c(CC(=O)C(C)(C)C)coc12 |
| InChI | InChI=1S/C15H18O3/c1-15(2,3)13(16)8-10-9-18-14-11(10)6-5-7-12(14)17-4/h5-7,9H,8H2,1-4H3 |
| InChIKey | GCOFHDPZSDPQMY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |