About dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate
dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate (PubChem CID 160930337) has the molecular formula C11H11ClCs2O7
and a molecular weight of 556.47 g/mol. Its IUPAC name is dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate.
Molecular Properties
| Compound Name | dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate |
| PubChem CID | 160930337 |
| Molecular Formula | C11H11ClCs2O7 |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 555.83 |
| IUPAC Name | dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate |
| SMILES | COC(=O)COc1cccc(CO)c1Cl.O=C([O-])[O-].[Cs+].[Cs+] |
| InChI | InChI=1S/C10H11ClO4.CH2O3.2Cs/c1-14-9(13)6-15-8-4-2-3-7(5-12)10(8)11;2-1(3)4;;/h2-4,12H,5-6H2,1H3;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | STEIQZSMNDGVEB-UHFFFAOYSA-L |
| XLogP | -7.05 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | -7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate?
The IUPAC name of dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate (CID 160930337) is dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate.
What is the SMILES notation for dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate?
The canonical SMILES for dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate is COC(=O)COc1cccc(CO)c1Cl.O=C([O-])[O-].[Cs+].[Cs+].
What is the InChIKey of dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate?
The InChIKey is STEIQZSMNDGVEB-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H11ClO4.CH2O3.2Cs/c1-14-9(13)6-15-8-4-2-3-7(5-12)10(8)11;2-1(3)4;;/h2-4,12H,5-6H2,1H3;(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate?
dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate has a molecular weight of 556.47 g/mol, XLogP of -7.05, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dicesium;methyl 2-[2-chloro-3-(hydroxymethyl)phenoxy]acetate;carbonate is sourced from PubChem (CID 160930337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).