About 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol
3-(2-aminoethoxy)-1,2-benzoxazol-7-ol (PubChem CID 84665269) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol.
Molecular Properties
| Compound Name | 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol |
| PubChem CID | 84665269 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol |
| SMILES | NCCOc1noc2c(O)cccc12 |
| InChI | InChI=1S/C9H10N2O3/c10-4-5-13-9-6-2-1-3-7(12)8(6)14-11-9/h1-3,12H,4-5,10H2 |
| InChIKey | XYMVMNLLYUYSFG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol?
The IUPAC name of 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol (CID 84665269) is 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol.
What is the SMILES notation for 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol?
The canonical SMILES for 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol is NCCOc1noc2c(O)cccc12.
What is the InChIKey of 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol?
The InChIKey is XYMVMNLLYUYSFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c10-4-5-13-9-6-2-1-3-7(12)8(6)14-11-9/h1-3,12H,4-5,10H2.
What are the key properties of 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol?
3-(2-aminoethoxy)-1,2-benzoxazol-7-ol has a molecular weight of 194.19 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethoxy)-1,2-benzoxazol-7-ol is sourced from PubChem (CID 84665269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).