C10H9N3O2 — CID 10420409
3-(2-aminoethoxy)-1,2-benzoxazole-4-carbonitrile (PubChem CID 10420409) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-1,2-benzoxazole-4-carbonitrile.
| Compound Name | 3-(2-aminoethoxy)-1,2-benzoxazole-4-carbonitrile |
|---|---|
| PubChem CID | 10420409 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-(2-aminoethoxy)-1,2-benzoxazole-4-carbonitrile |
| SMILES | N#Cc1cccc2onc(OCCN)c12 |
| InChI | InChI=1S/C10H9N3O2/c11-4-5-14-10-9-7(6-12)2-1-3-8(9)15-13-10/h1-3H,4-5,11H2 |
| InChIKey | FPYHDQYHBLQBFJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |