C11H11IN2O2 — CID 19596727
2-[(4-iodo-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine (PubChem CID 19596727) has the molecular formula C11H11IN2O2 and a molecular weight of 330.12 g/mol. Its IUPAC name is 2-[(4-iodo-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine.
| Compound Name | 2-[(4-iodo-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 19596727 |
| Molecular Formula | C11H11IN2O2 |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2-[(4-iodo-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine |
| SMILES | NCCOc1noc(-c2ccccc2)c1I |
| InChI | InChI=1S/C11H11IN2O2/c12-9-10(8-4-2-1-3-5-8)16-14-11(9)15-7-6-13/h1-5H,6-7,13H2 |
| InChIKey | QGDHFFPWWOLRLE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|