C10H10Cl2O3 — CID 67248346
2-[2,6-bis(chloromethyl)phenoxy]acetic acid (PubChem CID 67248346) has the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. Its IUPAC name is 2-[2,6-bis(chloromethyl)phenoxy]acetic acid.
| Compound Name | 2-[2,6-bis(chloromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 67248346 |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.09 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-[2,6-bis(chloromethyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(CCl)cccc1CCl |
| InChI | InChI=1S/C10H10Cl2O3/c11-4-7-2-1-3-8(5-12)10(7)15-6-9(13)14/h1-3H,4-6H2,(H,13,14) |
| InChIKey | ALCXKUFZIRKJPR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|