C12H6Cl2N2S — CID 55180550
4,6-dichloro-2-thiophen-2-ylquinazoline (PubChem CID 55180550) has the molecular formula C12H6Cl2N2S and a molecular weight of 281.17 g/mol. Its IUPAC name is 4,6-dichloro-2-thiophen-2-ylquinazoline.
| Compound Name | 4,6-dichloro-2-thiophen-2-ylquinazoline |
|---|---|
| PubChem CID | 55180550 |
| Molecular Formula | C12H6Cl2N2S |
| Molecular Weight | 281.17 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 4,6-dichloro-2-thiophen-2-ylquinazoline |
| SMILES | Clc1ccc2nc(-c3cccs3)nc(Cl)c2c1 |
| InChI | InChI=1S/C12H6Cl2N2S/c13-7-3-4-9-8(6-7)11(14)16-12(15-9)10-2-1-5-17-10/h1-6H |
| InChIKey | SAQZWNASPHJXFU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.17 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |