C16H15IN2OS — CID 163408935
2-iodo-3-[(4-methoxyphenyl)sulfanylmethyl]-6-methylimidazo[1,2-a]pyridine (PubChem CID 163408935) has the molecular formula C16H15IN2OS and a molecular weight of 410.28 g/mol. Its IUPAC name is 2-iodo-3-[(4-methoxyphenyl)sulfanylmethyl]-6-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-iodo-3-[(4-methoxyphenyl)sulfanylmethyl]-6-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 163408935 |
| Molecular Formula | C16H15IN2OS |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 2-iodo-3-[(4-methoxyphenyl)sulfanylmethyl]-6-methylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(SCc2c(I)nc3ccc(C)cn23)cc1 |
| InChI | InChI=1S/C16H15IN2OS/c1-11-3-8-15-18-16(17)14(19(15)9-11)10-21-13-6-4-12(20-2)5-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | MWKUTIJAGYATFN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|