C16H14Cl2N2O2 — CID 39133106
6-chloro-3-(chloromethyl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine (PubChem CID 39133106) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is 6-chloro-3-(chloromethyl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-3-(chloromethyl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 39133106 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 6-chloro-3-(chloromethyl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2nc3ccc(Cl)cn3c2CCl)cc1OC |
| InChI | InChI=1S/C16H14Cl2N2O2/c1-21-13-5-3-10(7-14(13)22-2)16-12(8-17)20-9-11(18)4-6-15(20)19-16/h3-7,9H,8H2,1-2H3 |
| InChIKey | NTDVAVCSTFBAHQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|